C13H19ClN4 — CID 114168556
N-(2-chloro-3-ethylpentyl)pyrazolo[1,5-a]pyrazin-4-amine (PubChem CID 114168556) has the molecular formula C13H19ClN4 and a molecular weight of 266.78 g/mol. Its IUPAC name is N-(2-chloro-3-ethylpentyl)pyrazolo[1,5-a]pyrazin-4-amine.
| Compound Name | N-(2-chloro-3-ethylpentyl)pyrazolo[1,5-a]pyrazin-4-amine |
|---|---|
| PubChem CID | 114168556 |
| Molecular Formula | C13H19ClN4 |
| Molecular Weight | 266.78 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | N-(2-chloro-3-ethylpentyl)pyrazolo[1,5-a]pyrazin-4-amine |
| SMILES | CCC(CC)C(Cl)CNc1nccn2nccc12 |
| InChI | InChI=1S/C13H19ClN4/c1-3-10(4-2)11(14)9-16-13-12-5-6-17-18(12)8-7-15-13/h5-8,10-11H,3-4,9H2,1-2H3,(H,15,16) |
| InChIKey | ZDJXJXCUWXHWQF-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.78 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|