C10H17N3O2 — CID 79247191
3-[[(2S)-1-hydroxy-3-methylbutan-2-yl]amino]-1-methylpyrazin-2-one (PubChem CID 79247191) has the molecular formula C10H17N3O2 and a molecular weight of 211.26 g/mol. Its IUPAC name is 3-[[(2S)-1-hydroxy-3-methylbutan-2-yl]amino]-1-methylpyrazin-2-one.
| Compound Name | 3-[[(2S)-1-hydroxy-3-methylbutan-2-yl]amino]-1-methylpyrazin-2-one |
|---|---|
| PubChem CID | 79247191 |
| Molecular Formula | C10H17N3O2 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | 3-[[(2S)-1-hydroxy-3-methylbutan-2-yl]amino]-1-methylpyrazin-2-one |
| SMILES | CC(C)[C@@H](CO)Nc1nccn(C)c1=O |
| InChI | InChI=1S/C10H17N3O2/c1-7(2)8(6-14)12-9-10(15)13(3)5-4-11-9/h4-5,7-8,14H,6H2,1-3H3,(H,11,12)/t8-/m1/s1 |
| InChIKey | SXULBHZHFZMHRJ-MRVPVSSYSA-N |
| XLogP | 0.21 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |