C10H14N6O2 — CID 80898117
ethyl 2-[(6-hydrazinylimidazo[1,2-a]pyrazin-8-yl)amino]acetate (PubChem CID 80898117) has the molecular formula C10H14N6O2 and a molecular weight of 250.26 g/mol. Its IUPAC name is ethyl 2-[(6-hydrazinylimidazo[1,2-a]pyrazin-8-yl)amino]acetate.
| Compound Name | ethyl 2-[(6-hydrazinylimidazo[1,2-a]pyrazin-8-yl)amino]acetate |
|---|---|
| PubChem CID | 80898117 |
| Molecular Formula | C10H14N6O2 |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | ethyl 2-[(6-hydrazinylimidazo[1,2-a]pyrazin-8-yl)amino]acetate |
| SMILES | CCOC(=O)CNc1nc(NN)cn2ccnc12 |
| InChI | InChI=1S/C10H14N6O2/c1-2-18-8(17)5-13-9-10-12-3-4-16(10)6-7(14-9)15-11/h3-4,6,15H,2,5,11H2,1H3,(H,13,14) |
| InChIKey | UFUWAXZCPQCQMJ-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 106.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|