C9H14N6O — CID 80933012
6-hydrazinyl-N-(2-methoxyethyl)imidazo[1,2-a]pyrazin-8-amine (PubChem CID 80933012) has the molecular formula C9H14N6O and a molecular weight of 222.25 g/mol. Its IUPAC name is 6-hydrazinyl-N-(2-methoxyethyl)imidazo[1,2-a]pyrazin-8-amine.
| Compound Name | 6-hydrazinyl-N-(2-methoxyethyl)imidazo[1,2-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 80933012 |
| Molecular Formula | C9H14N6O |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | 6-hydrazinyl-N-(2-methoxyethyl)imidazo[1,2-a]pyrazin-8-amine |
| SMILES | COCCNc1nc(NN)cn2ccnc12 |
| InChI | InChI=1S/C9H14N6O/c1-16-5-3-11-8-9-12-2-4-15(9)6-7(13-8)14-10/h2,4,6,14H,3,5,10H2,1H3,(H,11,13) |
| InChIKey | UUEKSVZTOLFNIP-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 89.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|