C14H16N6O — CID 80902450
6-hydrazinyl-N-(2-phenoxyethyl)imidazo[1,2-a]pyrazin-8-amine (PubChem CID 80902450) has the molecular formula C14H16N6O and a molecular weight of 284.32 g/mol. Its IUPAC name is 6-hydrazinyl-N-(2-phenoxyethyl)imidazo[1,2-a]pyrazin-8-amine.
| Compound Name | 6-hydrazinyl-N-(2-phenoxyethyl)imidazo[1,2-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 80902450 |
| Molecular Formula | C14H16N6O |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 6-hydrazinyl-N-(2-phenoxyethyl)imidazo[1,2-a]pyrazin-8-amine |
| SMILES | NNc1cn2ccnc2c(NCCOc2ccccc2)n1 |
| InChI | InChI=1S/C14H16N6O/c15-19-12-10-20-8-6-17-14(20)13(18-12)16-7-9-21-11-4-2-1-3-5-11/h1-6,8,10,19H,7,9,15H2,(H,16,18) |
| InChIKey | YYQOJHXVWYKMNH-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 89.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|