C13H13ClN6 — CID 80932131
N-[(2-chlorophenyl)methyl]-6-hydrazinylimidazo[1,2-a]pyrazin-8-amine (PubChem CID 80932131) has the molecular formula C13H13ClN6 and a molecular weight of 288.74 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-6-hydrazinylimidazo[1,2-a]pyrazin-8-amine.
| Compound Name | N-[(2-chlorophenyl)methyl]-6-hydrazinylimidazo[1,2-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 80932131 |
| Molecular Formula | C13H13ClN6 |
| Molecular Weight | 288.74 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-6-hydrazinylimidazo[1,2-a]pyrazin-8-amine |
| SMILES | NNc1cn2ccnc2c(NCc2ccccc2Cl)n1 |
| InChI | InChI=1S/C13H13ClN6/c14-10-4-2-1-3-9(10)7-17-12-13-16-5-6-20(13)8-11(18-12)19-15/h1-6,8,19H,7,15H2,(H,17,18) |
| InChIKey | OEXWYSUQDZKHHB-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 80.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.74 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|