C10H11N7O — CID 81173934
6-hydrazinyl-N-(1,2-oxazol-3-ylmethyl)imidazo[1,2-a]pyrazin-8-amine (PubChem CID 81173934) has the molecular formula C10H11N7O and a molecular weight of 245.25 g/mol. Its IUPAC name is 6-hydrazinyl-N-(1,2-oxazol-3-ylmethyl)imidazo[1,2-a]pyrazin-8-amine.
| Compound Name | 6-hydrazinyl-N-(1,2-oxazol-3-ylmethyl)imidazo[1,2-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 81173934 |
| Molecular Formula | C10H11N7O |
| Molecular Weight | 245.25 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | 6-hydrazinyl-N-(1,2-oxazol-3-ylmethyl)imidazo[1,2-a]pyrazin-8-amine |
| SMILES | NNc1cn2ccnc2c(NCc2ccon2)n1 |
| InChI | InChI=1S/C10H11N7O/c11-15-8-6-17-3-2-12-10(17)9(14-8)13-5-7-1-4-18-16-7/h1-4,6,15H,5,11H2,(H,13,14) |
| InChIKey | JVSXIFIORMGLQK-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 106.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.25 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|