C10H13N9 — CID 113413364
6-hydrazinyl-N-[2-(triazol-1-yl)ethyl]imidazo[1,2-a]pyrazin-8-amine (PubChem CID 113413364) has the molecular formula C10H13N9 and a molecular weight of 259.28 g/mol. Its IUPAC name is 6-hydrazinyl-N-[2-(triazol-1-yl)ethyl]imidazo[1,2-a]pyrazin-8-amine.
| Compound Name | 6-hydrazinyl-N-[2-(triazol-1-yl)ethyl]imidazo[1,2-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 113413364 |
| Molecular Formula | C10H13N9 |
| Molecular Weight | 259.28 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | 6-hydrazinyl-N-[2-(triazol-1-yl)ethyl]imidazo[1,2-a]pyrazin-8-amine |
| SMILES | NNc1cn2ccnc2c(NCCn2ccnn2)n1 |
| InChI | InChI=1S/C10H13N9/c11-16-8-7-18-4-1-13-10(18)9(15-8)12-2-5-19-6-3-14-17-19/h1,3-4,6-7,16H,2,5,11H2,(H,12,15) |
| InChIKey | SVCANPGCZUVDON-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 110.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.28 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|