C10H16N6 — CID 80931834
N-butyl-6-hydrazinylimidazo[1,2-a]pyrazin-8-amine (PubChem CID 80931834) has the molecular formula C10H16N6 and a molecular weight of 220.28 g/mol. Its IUPAC name is N-butyl-6-hydrazinylimidazo[1,2-a]pyrazin-8-amine.
| Compound Name | N-butyl-6-hydrazinylimidazo[1,2-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 80931834 |
| Molecular Formula | C10H16N6 |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.14 |
| IUPAC Name | N-butyl-6-hydrazinylimidazo[1,2-a]pyrazin-8-amine |
| SMILES | CCCCNc1nc(NN)cn2ccnc12 |
| InChI | InChI=1S/C10H16N6/c1-2-3-4-12-9-10-13-5-6-16(10)7-8(14-9)15-11/h5-7,15H,2-4,11H2,1H3,(H,12,14) |
| InChIKey | GDKXVLQUKFDXMA-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 80.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|