C14H23N5 — CID 80835650
6-N-ethyl-8-N-hexylimidazo[1,2-a]pyrazine-6,8-diamine (PubChem CID 80835650) has the molecular formula C14H23N5 and a molecular weight of 261.37 g/mol. Its IUPAC name is 6-N-ethyl-8-N-hexylimidazo[1,2-a]pyrazine-6,8-diamine.
| Compound Name | 6-N-ethyl-8-N-hexylimidazo[1,2-a]pyrazine-6,8-diamine |
|---|---|
| PubChem CID | 80835650 |
| Molecular Formula | C14H23N5 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.20 |
| IUPAC Name | 6-N-ethyl-8-N-hexylimidazo[1,2-a]pyrazine-6,8-diamine |
| SMILES | CCCCCCNc1nc(NCC)cn2ccnc12 |
| InChI | InChI=1S/C14H23N5/c1-3-5-6-7-8-16-13-14-17-9-10-19(14)11-12(18-13)15-4-2/h9-11,15H,3-8H2,1-2H3,(H,16,18) |
| InChIKey | AGHJMQVAISKSFG-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 54.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|