C12H19N5S — CID 113488442
6-N-methyl-8-N-(4-methylsulfanylbutyl)imidazo[1,2-a]pyrazine-6,8-diamine (PubChem CID 113488442) has the molecular formula C12H19N5S and a molecular weight of 265.39 g/mol. Its IUPAC name is 6-N-methyl-8-N-(4-methylsulfanylbutyl)imidazo[1,2-a]pyrazine-6,8-diamine.
| Compound Name | 6-N-methyl-8-N-(4-methylsulfanylbutyl)imidazo[1,2-a]pyrazine-6,8-diamine |
|---|---|
| PubChem CID | 113488442 |
| Molecular Formula | C12H19N5S |
| Molecular Weight | 265.39 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | 6-N-methyl-8-N-(4-methylsulfanylbutyl)imidazo[1,2-a]pyrazine-6,8-diamine |
| SMILES | CNc1cn2ccnc2c(NCCCCSC)n1 |
| InChI | InChI=1S/C12H19N5S/c1-13-10-9-17-7-6-15-12(17)11(16-10)14-5-3-4-8-18-2/h6-7,9,13H,3-5,8H2,1-2H3,(H,14,16) |
| InChIKey | QICFGYQZTPSAKA-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 54.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.39 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|