C10H12F3N5S — CID 106434075
6-N-methyl-8-N-[2-(trifluoromethylsulfanyl)ethyl]imidazo[1,2-a]pyrazine-6,8-diamine (PubChem CID 106434075) has the molecular formula C10H12F3N5S and a molecular weight of 291.30 g/mol. Its IUPAC name is 6-N-methyl-8-N-[2-(trifluoromethylsulfanyl)ethyl]imidazo[1,2-a]pyrazine-6,8-diamine.
| Compound Name | 6-N-methyl-8-N-[2-(trifluoromethylsulfanyl)ethyl]imidazo[1,2-a]pyrazine-6,8-diamine |
|---|---|
| PubChem CID | 106434075 |
| Molecular Formula | C10H12F3N5S |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | 6-N-methyl-8-N-[2-(trifluoromethylsulfanyl)ethyl]imidazo[1,2-a]pyrazine-6,8-diamine |
| SMILES | CNc1cn2ccnc2c(NCCSC(F)(F)F)n1 |
| InChI | InChI=1S/C10H12F3N5S/c1-14-7-6-18-4-2-16-9(18)8(17-7)15-3-5-19-10(11,12)13/h2,4,6,14H,3,5H2,1H3,(H,15,17) |
| InChIKey | BCMYLDIQMSXWSJ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 54.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|