C13H13ClN6O — CID 80900641
N-(2-chloro-5-methoxyphenyl)-6-hydrazinylimidazo[1,2-a]pyrazin-8-amine (PubChem CID 80900641) has the molecular formula C13H13ClN6O and a molecular weight of 304.74 g/mol. Its IUPAC name is N-(2-chloro-5-methoxyphenyl)-6-hydrazinylimidazo[1,2-a]pyrazin-8-amine.
| Compound Name | N-(2-chloro-5-methoxyphenyl)-6-hydrazinylimidazo[1,2-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 80900641 |
| Molecular Formula | C13H13ClN6O |
| Molecular Weight | 304.74 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | N-(2-chloro-5-methoxyphenyl)-6-hydrazinylimidazo[1,2-a]pyrazin-8-amine |
| SMILES | COc1ccc(Cl)c(Nc2nc(NN)cn3ccnc23)c1 |
| InChI | InChI=1S/C13H13ClN6O/c1-21-8-2-3-9(14)10(6-8)17-12-13-16-4-5-20(13)7-11(18-12)19-15/h2-7,19H,15H2,1H3,(H,17,18) |
| InChIKey | PXVOGWZFQNNSAK-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 89.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.74 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|