C12H10Br2N6 — CID 80896841
N-(2,5-dibromophenyl)-6-hydrazinylimidazo[1,2-a]pyrazin-8-amine (PubChem CID 80896841) has the molecular formula C12H10Br2N6 and a molecular weight of 398.06 g/mol. Its IUPAC name is N-(2,5-dibromophenyl)-6-hydrazinylimidazo[1,2-a]pyrazin-8-amine.
| Compound Name | N-(2,5-dibromophenyl)-6-hydrazinylimidazo[1,2-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 80896841 |
| Molecular Formula | C12H10Br2N6 |
| Molecular Weight | 398.06 g/mol |
| Exact Mass | 395.93 |
| IUPAC Name | N-(2,5-dibromophenyl)-6-hydrazinylimidazo[1,2-a]pyrazin-8-amine |
| SMILES | NNc1cn2ccnc2c(Nc2cc(Br)ccc2Br)n1 |
| InChI | InChI=1S/C12H10Br2N6/c13-7-1-2-8(14)9(5-7)17-11-12-16-3-4-20(12)6-10(18-11)19-15/h1-6,19H,15H2,(H,17,18) |
| InChIKey | CCSMCJAUAFHXQC-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 80.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.06 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|