C7H7BrN4 — CID 71156505
(6-bromoimidazo[1,2-a]pyridin-8-yl)hydrazine (PubChem CID 71156505) has the molecular formula C7H7BrN4 and a molecular weight of 227.06 g/mol. Its IUPAC name is (6-bromoimidazo[1,2-a]pyridin-8-yl)hydrazine.
| Compound Name | (6-bromoimidazo[1,2-a]pyridin-8-yl)hydrazine |
|---|---|
| PubChem CID | 71156505 |
| Molecular Formula | C7H7BrN4 |
| Molecular Weight | 227.06 g/mol |
| Exact Mass | 225.99 |
| IUPAC Name | (6-bromoimidazo[1,2-a]pyridin-8-yl)hydrazine |
| SMILES | NNc1cc(Br)cn2ccnc12 |
| InChI | InChI=1S/C7H7BrN4/c8-5-3-6(11-9)7-10-1-2-12(7)4-5/h1-4,11H,9H2 |
| InChIKey | ROUICYBEPHOVPH-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 55.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.06 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|