C12H9BrCl2N6 — CID 107795439
N-(4-bromo-2,3-dichlorophenyl)-6-hydrazinylimidazo[1,2-a]pyrazin-8-amine (PubChem CID 107795439) has the molecular formula C12H9BrCl2N6 and a molecular weight of 388.06 g/mol. Its IUPAC name is N-(4-bromo-2,3-dichlorophenyl)-6-hydrazinylimidazo[1,2-a]pyrazin-8-amine.
| Compound Name | N-(4-bromo-2,3-dichlorophenyl)-6-hydrazinylimidazo[1,2-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 107795439 |
| Molecular Formula | C12H9BrCl2N6 |
| Molecular Weight | 388.06 g/mol |
| Exact Mass | 385.94 |
| IUPAC Name | N-(4-bromo-2,3-dichlorophenyl)-6-hydrazinylimidazo[1,2-a]pyrazin-8-amine |
| SMILES | NNc1cn2ccnc2c(Nc2ccc(Br)c(Cl)c2Cl)n1 |
| InChI | InChI=1S/C12H9BrCl2N6/c13-6-1-2-7(10(15)9(6)14)18-11-12-17-3-4-21(12)5-8(19-11)20-16/h1-5,20H,16H2,(H,18,19) |
| InChIKey | XUEIPFJZIOYLBE-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 80.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.06 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|