C13H10FN7 — CID 82682483
5-fluoro-2-[(6-hydrazinylimidazo[1,2-a]pyrazin-8-yl)amino]benzonitrile (PubChem CID 82682483) has the molecular formula C13H10FN7 and a molecular weight of 283.27 g/mol. Its IUPAC name is 5-fluoro-2-[(6-hydrazinylimidazo[1,2-a]pyrazin-8-yl)amino]benzonitrile.
| Compound Name | 5-fluoro-2-[(6-hydrazinylimidazo[1,2-a]pyrazin-8-yl)amino]benzonitrile |
|---|---|
| PubChem CID | 82682483 |
| Molecular Formula | C13H10FN7 |
| Molecular Weight | 283.27 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 5-fluoro-2-[(6-hydrazinylimidazo[1,2-a]pyrazin-8-yl)amino]benzonitrile |
| SMILES | N#Cc1cc(F)ccc1Nc1nc(NN)cn2ccnc12 |
| InChI | InChI=1S/C13H10FN7/c14-9-1-2-10(8(5-9)6-15)18-12-13-17-3-4-21(13)7-11(19-12)20-16/h1-5,7,20H,16H2,(H,18,19) |
| InChIKey | LRZLROKZCUPIEU-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.27 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|