C14H13N7 — CID 80903968
2-[4-[(6-hydrazinylimidazo[1,2-a]pyrazin-8-yl)amino]phenyl]acetonitrile (PubChem CID 80903968) has the molecular formula C14H13N7 and a molecular weight of 279.31 g/mol. Its IUPAC name is 2-[4-[(6-hydrazinylimidazo[1,2-a]pyrazin-8-yl)amino]phenyl]acetonitrile.
| Compound Name | 2-[4-[(6-hydrazinylimidazo[1,2-a]pyrazin-8-yl)amino]phenyl]acetonitrile |
|---|---|
| PubChem CID | 80903968 |
| Molecular Formula | C14H13N7 |
| Molecular Weight | 279.31 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | 2-[4-[(6-hydrazinylimidazo[1,2-a]pyrazin-8-yl)amino]phenyl]acetonitrile |
| SMILES | N#CCc1ccc(Nc2nc(NN)cn3ccnc23)cc1 |
| InChI | InChI=1S/C14H13N7/c15-6-5-10-1-3-11(4-2-10)18-13-14-17-7-8-21(14)9-12(19-13)20-16/h1-4,7-9,20H,5,16H2,(H,18,19) |
| InChIKey | IIVQOKXWTDUHQS-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.31 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|