About N-(4-chloro-3-methoxyphenyl)-6-hydrazinylimidazo[1,2-a]pyrazin-8-amine
N-(4-chloro-3-methoxyphenyl)-6-hydrazinylimidazo[1,2-a]pyrazin-8-amine (PubChem CID 107623718) has the molecular formula C13H13ClN6O
and a molecular weight of 304.74 g/mol. Its IUPAC name is N-(4-chloro-3-methoxyphenyl)-6-hydrazinylimidazo[1,2-a]pyrazin-8-amine.
Molecular Properties
| Compound Name | N-(4-chloro-3-methoxyphenyl)-6-hydrazinylimidazo[1,2-a]pyrazin-8-amine |
| PubChem CID | 107623718 |
| Molecular Formula | C13H13ClN6O |
| Molecular Weight | 304.74 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | N-(4-chloro-3-methoxyphenyl)-6-hydrazinylimidazo[1,2-a]pyrazin-8-amine |
| SMILES | COc1cc(Nc2nc(NN)cn3ccnc23)ccc1Cl |
| InChI | InChI=1S/C13H13ClN6O/c1-21-10-6-8(2-3-9(10)14)17-12-13-16-4-5-20(13)7-11(18-12)19-15/h2-7,19H,15H2,1H3,(H,17,18) |
| InChIKey | IOWYICWQKOHFIW-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 89.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.74 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(4-chloro-3-methoxyphenyl)-6-hydrazinylimidazo[1,2-a]pyrazin-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-chloro-3-methoxyphenyl)-6-hydrazinylimidazo[1,2-a]pyrazin-8-amine?
The IUPAC name of N-(4-chloro-3-methoxyphenyl)-6-hydrazinylimidazo[1,2-a]pyrazin-8-amine (CID 107623718) is N-(4-chloro-3-methoxyphenyl)-6-hydrazinylimidazo[1,2-a]pyrazin-8-amine.
What is the SMILES notation for N-(4-chloro-3-methoxyphenyl)-6-hydrazinylimidazo[1,2-a]pyrazin-8-amine?
The canonical SMILES for N-(4-chloro-3-methoxyphenyl)-6-hydrazinylimidazo[1,2-a]pyrazin-8-amine is COc1cc(Nc2nc(NN)cn3ccnc23)ccc1Cl.
What is the InChIKey of N-(4-chloro-3-methoxyphenyl)-6-hydrazinylimidazo[1,2-a]pyrazin-8-amine?
The InChIKey is IOWYICWQKOHFIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13ClN6O/c1-21-10-6-8(2-3-9(10)14)17-12-13-16-4-5-20(13)7-11(18-12)19-15/h2-7,19H,15H2,1H3,(H,17,18).
What are the key properties of N-(4-chloro-3-methoxyphenyl)-6-hydrazinylimidazo[1,2-a]pyrazin-8-amine?
N-(4-chloro-3-methoxyphenyl)-6-hydrazinylimidazo[1,2-a]pyrazin-8-amine has a molecular weight of 304.74 g/mol, XLogP of 2.42, 4 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-chloro-3-methoxyphenyl)-6-hydrazinylimidazo[1,2-a]pyrazin-8-amine is sourced from PubChem (CID 107623718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).