C12H9Cl2N5O — CID 80915231
[8-(2,4-dichlorophenoxy)imidazo[1,2-a]pyrazin-6-yl]hydrazine (PubChem CID 80915231) has the molecular formula C12H9Cl2N5O and a molecular weight of 310.14 g/mol. Its IUPAC name is [8-(2,4-dichlorophenoxy)imidazo[1,2-a]pyrazin-6-yl]hydrazine.
| Compound Name | [8-(2,4-dichlorophenoxy)imidazo[1,2-a]pyrazin-6-yl]hydrazine |
|---|---|
| PubChem CID | 80915231 |
| Molecular Formula | C12H9Cl2N5O |
| Molecular Weight | 310.14 g/mol |
| Exact Mass | 309.02 |
| IUPAC Name | [8-(2,4-dichlorophenoxy)imidazo[1,2-a]pyrazin-6-yl]hydrazine |
| SMILES | NNc1cn2ccnc2c(Oc2ccc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C12H9Cl2N5O/c13-7-1-2-9(8(14)5-7)20-12-11-16-3-4-19(11)6-10(17-12)18-15/h1-6,18H,15H2 |
| InChIKey | XSRDHRXVJNKCOU-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 77.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.14 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|