C12H8Cl3N5O — CID 80909574
[8-(2,4,5-trichlorophenoxy)imidazo[1,2-a]pyrazin-6-yl]hydrazine (PubChem CID 80909574) has the molecular formula C12H8Cl3N5O and a molecular weight of 344.59 g/mol. Its IUPAC name is [8-(2,4,5-trichlorophenoxy)imidazo[1,2-a]pyrazin-6-yl]hydrazine.
| Compound Name | [8-(2,4,5-trichlorophenoxy)imidazo[1,2-a]pyrazin-6-yl]hydrazine |
|---|---|
| PubChem CID | 80909574 |
| Molecular Formula | C12H8Cl3N5O |
| Molecular Weight | 344.59 g/mol |
| Exact Mass | 342.98 |
| IUPAC Name | [8-(2,4,5-trichlorophenoxy)imidazo[1,2-a]pyrazin-6-yl]hydrazine |
| SMILES | NNc1cn2ccnc2c(Oc2cc(Cl)c(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C12H8Cl3N5O/c13-6-3-8(15)9(4-7(6)14)21-12-11-17-1-2-20(11)5-10(18-12)19-16/h1-5,19H,16H2 |
| InChIKey | SHXYMRDSOQOCRO-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 77.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.59 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|