C13H13N5O2 — CID 80915169
[8-(3-methoxyphenoxy)imidazo[1,2-a]pyrazin-6-yl]hydrazine (PubChem CID 80915169) has the molecular formula C13H13N5O2 and a molecular weight of 271.28 g/mol. Its IUPAC name is [8-(3-methoxyphenoxy)imidazo[1,2-a]pyrazin-6-yl]hydrazine.
| Compound Name | [8-(3-methoxyphenoxy)imidazo[1,2-a]pyrazin-6-yl]hydrazine |
|---|---|
| PubChem CID | 80915169 |
| Molecular Formula | C13H13N5O2 |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | [8-(3-methoxyphenoxy)imidazo[1,2-a]pyrazin-6-yl]hydrazine |
| SMILES | COc1cccc(Oc2nc(NN)cn3ccnc23)c1 |
| InChI | InChI=1S/C13H13N5O2/c1-19-9-3-2-4-10(7-9)20-13-12-15-5-6-18(12)8-11(16-13)17-14/h2-8,17H,14H2,1H3 |
| InChIKey | LNWAWKUJUYYDSX-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 86.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|