C13H10F2N4O — CID 80863100
8-(2,4-difluorophenoxy)-N-methylimidazo[1,2-a]pyrazin-6-amine (PubChem CID 80863100) has the molecular formula C13H10F2N4O and a molecular weight of 276.25 g/mol. Its IUPAC name is 8-(2,4-difluorophenoxy)-N-methylimidazo[1,2-a]pyrazin-6-amine.
| Compound Name | 8-(2,4-difluorophenoxy)-N-methylimidazo[1,2-a]pyrazin-6-amine |
|---|---|
| PubChem CID | 80863100 |
| Molecular Formula | C13H10F2N4O |
| Molecular Weight | 276.25 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | 8-(2,4-difluorophenoxy)-N-methylimidazo[1,2-a]pyrazin-6-amine |
| SMILES | CNc1cn2ccnc2c(Oc2ccc(F)cc2F)n1 |
| InChI | InChI=1S/C13H10F2N4O/c1-16-11-7-19-5-4-17-12(19)13(18-11)20-10-3-2-8(14)6-9(10)15/h2-7,16H,1H3 |
| InChIKey | BLPJXZQMEFNXBF-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 51.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.25 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |