C13H11N5O3 — CID 80875312
N-methyl-8-(2-nitrophenoxy)imidazo[1,2-a]pyrazin-6-amine (PubChem CID 80875312) has the molecular formula C13H11N5O3 and a molecular weight of 285.26 g/mol. Its IUPAC name is N-methyl-8-(2-nitrophenoxy)imidazo[1,2-a]pyrazin-6-amine.
| Compound Name | N-methyl-8-(2-nitrophenoxy)imidazo[1,2-a]pyrazin-6-amine |
|---|---|
| PubChem CID | 80875312 |
| Molecular Formula | C13H11N5O3 |
| Molecular Weight | 285.26 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | N-methyl-8-(2-nitrophenoxy)imidazo[1,2-a]pyrazin-6-amine |
| SMILES | CNc1cn2ccnc2c(Oc2ccccc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C13H11N5O3/c1-14-11-8-17-7-6-15-12(17)13(16-11)21-10-5-3-2-4-9(10)18(19)20/h2-8,14H,1H3 |
| InChIKey | XENVGXZWPRUCJP-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.26 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|