C14H13FN4O — CID 80864193
N-ethyl-8-(2-fluorophenoxy)imidazo[1,2-a]pyrazin-6-amine (PubChem CID 80864193) has the molecular formula C14H13FN4O and a molecular weight of 272.28 g/mol. Its IUPAC name is N-ethyl-8-(2-fluorophenoxy)imidazo[1,2-a]pyrazin-6-amine.
| Compound Name | N-ethyl-8-(2-fluorophenoxy)imidazo[1,2-a]pyrazin-6-amine |
|---|---|
| PubChem CID | 80864193 |
| Molecular Formula | C14H13FN4O |
| Molecular Weight | 272.28 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | N-ethyl-8-(2-fluorophenoxy)imidazo[1,2-a]pyrazin-6-amine |
| SMILES | CCNc1cn2ccnc2c(Oc2ccccc2F)n1 |
| InChI | InChI=1S/C14H13FN4O/c1-2-16-12-9-19-8-7-17-13(19)14(18-12)20-11-6-4-3-5-10(11)15/h3-9,16H,2H2,1H3 |
| InChIKey | DMMAIZQINHQRJL-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 51.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.28 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |