C10H11N9S — CID 80923576
2-(6-hydrazinylimidazo[1,2-a]pyrazin-8-yl)sulfanylpyrimidine-4,6-diamine (PubChem CID 80923576) has the molecular formula C10H11N9S and a molecular weight of 289.33 g/mol. Its IUPAC name is 2-(6-hydrazinylimidazo[1,2-a]pyrazin-8-yl)sulfanylpyrimidine-4,6-diamine.
| Compound Name | 2-(6-hydrazinylimidazo[1,2-a]pyrazin-8-yl)sulfanylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 80923576 |
| Molecular Formula | C10H11N9S |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 2-(6-hydrazinylimidazo[1,2-a]pyrazin-8-yl)sulfanylpyrimidine-4,6-diamine |
| SMILES | NNc1cn2ccnc2c(Sc2nc(N)cc(N)n2)n1 |
| InChI | InChI=1S/C10H11N9S/c11-5-3-6(12)16-10(15-5)20-9-8-14-1-2-19(8)4-7(17-9)18-13/h1-4,18H,13H2,(H4,11,12,15,16) |
| InChIKey | COSJJYLUHUKWRM-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 146.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|