C12H10BrN5S — CID 80925919
[8-(2-bromophenyl)sulfanylimidazo[1,2-a]pyrazin-6-yl]hydrazine (PubChem CID 80925919) has the molecular formula C12H10BrN5S and a molecular weight of 336.22 g/mol. Its IUPAC name is [8-(2-bromophenyl)sulfanylimidazo[1,2-a]pyrazin-6-yl]hydrazine.
| Compound Name | [8-(2-bromophenyl)sulfanylimidazo[1,2-a]pyrazin-6-yl]hydrazine |
|---|---|
| PubChem CID | 80925919 |
| Molecular Formula | C12H10BrN5S |
| Molecular Weight | 336.22 g/mol |
| Exact Mass | 334.98 |
| IUPAC Name | [8-(2-bromophenyl)sulfanylimidazo[1,2-a]pyrazin-6-yl]hydrazine |
| SMILES | NNc1cn2ccnc2c(Sc2ccccc2Br)n1 |
| InChI | InChI=1S/C12H10BrN5S/c13-8-3-1-2-4-9(8)19-12-11-15-5-6-18(11)7-10(16-12)17-14/h1-7,17H,14H2 |
| InChIKey | YJEZMAPYTNCYSO-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 68.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.22 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|