C11H12N6OS — CID 106928883
[8-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]imidazo[1,2-a]pyrazin-6-yl]hydrazine (PubChem CID 106928883) has the molecular formula C11H12N6OS and a molecular weight of 276.33 g/mol. Its IUPAC name is [8-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]imidazo[1,2-a]pyrazin-6-yl]hydrazine.
| Compound Name | [8-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]imidazo[1,2-a]pyrazin-6-yl]hydrazine |
|---|---|
| PubChem CID | 106928883 |
| Molecular Formula | C11H12N6OS |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | [8-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]imidazo[1,2-a]pyrazin-6-yl]hydrazine |
| SMILES | Cc1nc(Sc2nc(NN)cn3ccnc23)oc1C |
| InChI | InChI=1S/C11H12N6OS/c1-6-7(2)18-11(14-6)19-10-9-13-3-4-17(9)5-8(15-10)16-12/h3-5,16H,12H2,1-2H3 |
| InChIKey | GUQTVAFFUXQNHE-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 94.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|