C10H12N4OS — CID 106928865
[6-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]-2-pyridinyl]hydrazine (PubChem CID 106928865) has the molecular formula C10H12N4OS and a molecular weight of 236.30 g/mol. Its IUPAC name is [6-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]-2-pyridinyl]hydrazine.
| Compound Name | [6-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]-2-pyridinyl]hydrazine |
|---|---|
| PubChem CID | 106928865 |
| Molecular Formula | C10H12N4OS |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | [6-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]-2-pyridinyl]hydrazine |
| SMILES | Cc1nc(Sc2cccc(NN)n2)oc1C |
| InChI | InChI=1S/C10H12N4OS/c1-6-7(2)15-10(12-6)16-9-5-3-4-8(13-9)14-11/h3-5H,11H2,1-2H3,(H,13,14) |
| InChIKey | CGSLPWDCKDZFSL-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|