C9H15N3S — CID 80924851
[6-(2-methylpropylsulfanyl)-2-pyridinyl]hydrazine (PubChem CID 80924851) has the molecular formula C9H15N3S and a molecular weight of 197.31 g/mol. Its IUPAC name is [6-(2-methylpropylsulfanyl)-2-pyridinyl]hydrazine.
| Compound Name | [6-(2-methylpropylsulfanyl)-2-pyridinyl]hydrazine |
|---|---|
| PubChem CID | 80924851 |
| Molecular Formula | C9H15N3S |
| Molecular Weight | 197.31 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | [6-(2-methylpropylsulfanyl)-2-pyridinyl]hydrazine |
| SMILES | CC(C)CSc1cccc(NN)n1 |
| InChI | InChI=1S/C9H15N3S/c1-7(2)6-13-9-5-3-4-8(11-9)12-10/h3-5,7H,6,10H2,1-2H3,(H,11,12) |
| InChIKey | ULXRCKHKHXYAAJ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.31 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|