C9H16N4S2 — CID 80925282
[6-(2-methylpropylsulfanyl)-2-methylsulfanylpyrimidin-4-yl]hydrazine (PubChem CID 80925282) has the molecular formula C9H16N4S2 and a molecular weight of 244.39 g/mol. Its IUPAC name is [6-(2-methylpropylsulfanyl)-2-methylsulfanylpyrimidin-4-yl]hydrazine.
| Compound Name | [6-(2-methylpropylsulfanyl)-2-methylsulfanylpyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 80925282 |
| Molecular Formula | C9H16N4S2 |
| Molecular Weight | 244.39 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | [6-(2-methylpropylsulfanyl)-2-methylsulfanylpyrimidin-4-yl]hydrazine |
| SMILES | CSc1nc(NN)cc(SCC(C)C)n1 |
| InChI | InChI=1S/C9H16N4S2/c1-6(2)5-15-8-4-7(13-10)11-9(12-8)14-3/h4,6H,5,10H2,1-3H3,(H,11,12,13) |
| InChIKey | WLUFOUFQAHYCEZ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.39 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|