C8H15N5OS — CID 80929005
3-(2-amino-6-hydrazinylpyrimidin-4-yl)sulfanyl-2-methylpropan-1-ol (PubChem CID 80929005) has the molecular formula C8H15N5OS and a molecular weight of 229.31 g/mol. Its IUPAC name is 3-(2-amino-6-hydrazinylpyrimidin-4-yl)sulfanyl-2-methylpropan-1-ol.
| Compound Name | 3-(2-amino-6-hydrazinylpyrimidin-4-yl)sulfanyl-2-methylpropan-1-ol |
|---|---|
| PubChem CID | 80929005 |
| Molecular Formula | C8H15N5OS |
| Molecular Weight | 229.31 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | 3-(2-amino-6-hydrazinylpyrimidin-4-yl)sulfanyl-2-methylpropan-1-ol |
| SMILES | CC(CO)CSc1cc(NN)nc(N)n1 |
| InChI | InChI=1S/C8H15N5OS/c1-5(3-14)4-15-7-2-6(13-10)11-8(9)12-7/h2,5,14H,3-4,10H2,1H3,(H3,9,11,12,13) |
| InChIKey | DVZYLEDHNHUUBF-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.31 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|