C9H16N4O2S — CID 80938523
3-(2-ethyl-6-hydrazinylpyrimidin-4-yl)sulfanylpropane-1,2-diol (PubChem CID 80938523) has the molecular formula C9H16N4O2S and a molecular weight of 244.32 g/mol. Its IUPAC name is 3-(2-ethyl-6-hydrazinylpyrimidin-4-yl)sulfanylpropane-1,2-diol.
| Compound Name | 3-(2-ethyl-6-hydrazinylpyrimidin-4-yl)sulfanylpropane-1,2-diol |
|---|---|
| PubChem CID | 80938523 |
| Molecular Formula | C9H16N4O2S |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 3-(2-ethyl-6-hydrazinylpyrimidin-4-yl)sulfanylpropane-1,2-diol |
| SMILES | CCc1nc(NN)cc(SCC(O)CO)n1 |
| InChI | InChI=1S/C9H16N4O2S/c1-2-7-11-8(13-10)3-9(12-7)16-5-6(15)4-14/h3,6,14-15H,2,4-5,10H2,1H3,(H,11,12,13) |
| InChIKey | JOBRLDJSRBDCCJ-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|