C15H19N3O2S — CID 115916082
3-[6-(ethylamino)-2-phenylpyrimidin-4-yl]sulfanylpropane-1,2-diol (PubChem CID 115916082) has the molecular formula C15H19N3O2S and a molecular weight of 305.40 g/mol. Its IUPAC name is 3-[6-(ethylamino)-2-phenylpyrimidin-4-yl]sulfanylpropane-1,2-diol.
| Compound Name | 3-[6-(ethylamino)-2-phenylpyrimidin-4-yl]sulfanylpropane-1,2-diol |
|---|---|
| PubChem CID | 115916082 |
| Molecular Formula | C15H19N3O2S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 3-[6-(ethylamino)-2-phenylpyrimidin-4-yl]sulfanylpropane-1,2-diol |
| SMILES | CCNc1cc(SCC(O)CO)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C15H19N3O2S/c1-2-16-13-8-14(21-10-12(20)9-19)18-15(17-13)11-6-4-3-5-7-11/h3-8,12,19-20H,2,9-10H2,1H3,(H,16,17,18) |
| InChIKey | GOYVBNQVLQPNKJ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |