C14H16F2N4 — CID 115915739
4-N-(2,2-difluoroethyl)-6-N-ethyl-2-phenylpyrimidine-4,6-diamine (PubChem CID 115915739) has the molecular formula C14H16F2N4 and a molecular weight of 278.31 g/mol. Its IUPAC name is 4-N-(2,2-difluoroethyl)-6-N-ethyl-2-phenylpyrimidine-4,6-diamine.
| Compound Name | 4-N-(2,2-difluoroethyl)-6-N-ethyl-2-phenylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 115915739 |
| Molecular Formula | C14H16F2N4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 4-N-(2,2-difluoroethyl)-6-N-ethyl-2-phenylpyrimidine-4,6-diamine |
| SMILES | CCNc1cc(NCC(F)F)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C14H16F2N4/c1-2-17-12-8-13(18-9-11(15)16)20-14(19-12)10-6-4-3-5-7-10/h3-8,11H,2,9H2,1H3,(H2,17,18,19,20) |
| InChIKey | SBUVKMRVKDCPNQ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |