C9H17N5O2 — CID 80937394
2-[(2-ethyl-6-hydrazinylpyrimidin-4-yl)amino]propane-1,3-diol (PubChem CID 80937394) has the molecular formula C9H17N5O2 and a molecular weight of 227.27 g/mol. Its IUPAC name is 2-[(2-ethyl-6-hydrazinylpyrimidin-4-yl)amino]propane-1,3-diol.
| Compound Name | 2-[(2-ethyl-6-hydrazinylpyrimidin-4-yl)amino]propane-1,3-diol |
|---|---|
| PubChem CID | 80937394 |
| Molecular Formula | C9H17N5O2 |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 227.14 |
| IUPAC Name | 2-[(2-ethyl-6-hydrazinylpyrimidin-4-yl)amino]propane-1,3-diol |
| SMILES | CCc1nc(NN)cc(NC(CO)CO)n1 |
| InChI | InChI=1S/C9H17N5O2/c1-2-7-12-8(3-9(13-7)14-10)11-6(4-15)5-16/h3,6,15-16H,2,4-5,10H2,1H3,(H2,11,12,13,14) |
| InChIKey | CREZLMRZTZLZAV-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 116.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|