C9H14N2O3S — CID 114578951
4-(2,3-dihydroxypropylsulfanyl)-2-ethyl-1H-pyrimidin-6-one (PubChem CID 114578951) has the molecular formula C9H14N2O3S and a molecular weight of 230.29 g/mol. Its IUPAC name is 4-(2,3-dihydroxypropylsulfanyl)-2-ethyl-1H-pyrimidin-6-one.
| Compound Name | 4-(2,3-dihydroxypropylsulfanyl)-2-ethyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 114578951 |
| Molecular Formula | C9H14N2O3S |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 4-(2,3-dihydroxypropylsulfanyl)-2-ethyl-1H-pyrimidin-6-one |
| SMILES | CCc1nc(SCC(O)CO)cc(=O)[nH]1 |
| InChI | InChI=1S/C9H14N2O3S/c1-2-7-10-8(14)3-9(11-7)15-5-6(13)4-12/h3,6,12-13H,2,4-5H2,1H3,(H,10,11,14) |
| InChIKey | WOXMYRHKGSMIIR-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 86.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |