C10H13F3N2OS — CID 102720381
3-[[6-amino-4-(trifluoromethyl)-2-pyridinyl]sulfanyl]-2-methylpropan-1-ol (PubChem CID 102720381) has the molecular formula C10H13F3N2OS and a molecular weight of 266.29 g/mol. Its IUPAC name is 3-[[6-amino-4-(trifluoromethyl)-2-pyridinyl]sulfanyl]-2-methylpropan-1-ol.
| Compound Name | 3-[[6-amino-4-(trifluoromethyl)-2-pyridinyl]sulfanyl]-2-methylpropan-1-ol |
|---|---|
| PubChem CID | 102720381 |
| Molecular Formula | C10H13F3N2OS |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 3-[[6-amino-4-(trifluoromethyl)-2-pyridinyl]sulfanyl]-2-methylpropan-1-ol |
| SMILES | CC(CO)CSc1cc(C(F)(F)F)cc(N)n1 |
| InChI | InChI=1S/C10H13F3N2OS/c1-6(4-16)5-17-9-3-7(10(11,12)13)2-8(14)15-9/h2-3,6,16H,4-5H2,1H3,(H2,14,15) |
| InChIKey | VSXCWILWTWPTNC-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |