C10H14F3N3OS — CID 114566873
2-methyl-3-[2-(methylamino)-6-(trifluoromethyl)pyrimidin-4-yl]sulfanylpropan-1-ol (PubChem CID 114566873) has the molecular formula C10H14F3N3OS and a molecular weight of 281.30 g/mol. Its IUPAC name is 2-methyl-3-[2-(methylamino)-6-(trifluoromethyl)pyrimidin-4-yl]sulfanylpropan-1-ol.
| Compound Name | 2-methyl-3-[2-(methylamino)-6-(trifluoromethyl)pyrimidin-4-yl]sulfanylpropan-1-ol |
|---|---|
| PubChem CID | 114566873 |
| Molecular Formula | C10H14F3N3OS |
| Molecular Weight | 281.30 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 2-methyl-3-[2-(methylamino)-6-(trifluoromethyl)pyrimidin-4-yl]sulfanylpropan-1-ol |
| SMILES | CNc1nc(SCC(C)CO)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C10H14F3N3OS/c1-6(4-17)5-18-8-3-7(10(11,12)13)15-9(14-2)16-8/h3,6,17H,4-5H2,1-2H3,(H,14,15,16) |
| InChIKey | HLISLVXIIRXPAP-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.30 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |