C11H16F3N3S — CID 114566701
4-tert-butylsulfanyl-N-ethyl-6-(trifluoromethyl)pyrimidin-2-amine (PubChem CID 114566701) has the molecular formula C11H16F3N3S and a molecular weight of 279.33 g/mol. Its IUPAC name is 4-tert-butylsulfanyl-N-ethyl-6-(trifluoromethyl)pyrimidin-2-amine.
| Compound Name | 4-tert-butylsulfanyl-N-ethyl-6-(trifluoromethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 114566701 |
| Molecular Formula | C11H16F3N3S |
| Molecular Weight | 279.33 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 4-tert-butylsulfanyl-N-ethyl-6-(trifluoromethyl)pyrimidin-2-amine |
| SMILES | CCNc1nc(SC(C)(C)C)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C11H16F3N3S/c1-5-15-9-16-7(11(12,13)14)6-8(17-9)18-10(2,3)4/h6H,5H2,1-4H3,(H,15,16,17) |
| InChIKey | ZYFQEWMRKYLQRM-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.33 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |