C14H20F3N3S — CID 114566838
4-(cyclopentylmethylsulfanyl)-N-propyl-6-(trifluoromethyl)pyrimidin-2-amine (PubChem CID 114566838) has the molecular formula C14H20F3N3S and a molecular weight of 319.40 g/mol. Its IUPAC name is 4-(cyclopentylmethylsulfanyl)-N-propyl-6-(trifluoromethyl)pyrimidin-2-amine.
| Compound Name | 4-(cyclopentylmethylsulfanyl)-N-propyl-6-(trifluoromethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 114566838 |
| Molecular Formula | C14H20F3N3S |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | 4-(cyclopentylmethylsulfanyl)-N-propyl-6-(trifluoromethyl)pyrimidin-2-amine |
| SMILES | CCCNc1nc(SCC2CCCC2)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C14H20F3N3S/c1-2-7-18-13-19-11(14(15,16)17)8-12(20-13)21-9-10-5-3-4-6-10/h8,10H,2-7,9H2,1H3,(H,18,19,20) |
| InChIKey | CNIQHYGFZLOOLG-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |