C10H13F3N4OS — CID 106498029
[4-(oxolan-2-ylmethylsulfanyl)-6-(trifluoromethyl)pyrimidin-2-yl]hydrazine (PubChem CID 106498029) has the molecular formula C10H13F3N4OS and a molecular weight of 294.30 g/mol. Its IUPAC name is [4-(oxolan-2-ylmethylsulfanyl)-6-(trifluoromethyl)pyrimidin-2-yl]hydrazine.
| Compound Name | [4-(oxolan-2-ylmethylsulfanyl)-6-(trifluoromethyl)pyrimidin-2-yl]hydrazine |
|---|---|
| PubChem CID | 106498029 |
| Molecular Formula | C10H13F3N4OS |
| Molecular Weight | 294.30 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | [4-(oxolan-2-ylmethylsulfanyl)-6-(trifluoromethyl)pyrimidin-2-yl]hydrazine |
| SMILES | NNc1nc(SCC2CCCO2)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C10H13F3N4OS/c11-10(12,13)7-4-8(16-9(15-7)17-14)19-5-6-2-1-3-18-6/h4,6H,1-3,5,14H2,(H,15,16,17) |
| InChIKey | WKIXIHLVEOBMEU-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.30 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|