C11H17N3OS — CID 106497707
N,2-dimethyl-6-(oxolan-2-ylmethylsulfanyl)pyrimidin-4-amine (PubChem CID 106497707) has the molecular formula C11H17N3OS and a molecular weight of 239.34 g/mol. Its IUPAC name is N,2-dimethyl-6-(oxolan-2-ylmethylsulfanyl)pyrimidin-4-amine.
| Compound Name | N,2-dimethyl-6-(oxolan-2-ylmethylsulfanyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 106497707 |
| Molecular Formula | C11H17N3OS |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | N,2-dimethyl-6-(oxolan-2-ylmethylsulfanyl)pyrimidin-4-amine |
| SMILES | CNc1cc(SCC2CCCO2)nc(C)n1 |
| InChI | InChI=1S/C11H17N3OS/c1-8-13-10(12-2)6-11(14-8)16-7-9-4-3-5-15-9/h6,9H,3-5,7H2,1-2H3,(H,12,13,14) |
| InChIKey | GIADZVHESSPUPD-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |