C9H13N3OS — CID 106497698
6-(oxolan-2-ylmethylsulfanyl)pyrimidin-4-amine (PubChem CID 106497698) has the molecular formula C9H13N3OS and a molecular weight of 211.29 g/mol. Its IUPAC name is 6-(oxolan-2-ylmethylsulfanyl)pyrimidin-4-amine.
| Compound Name | 6-(oxolan-2-ylmethylsulfanyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 106497698 |
| Molecular Formula | C9H13N3OS |
| Molecular Weight | 211.29 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 6-(oxolan-2-ylmethylsulfanyl)pyrimidin-4-amine |
| SMILES | Nc1cc(SCC2CCCO2)ncn1 |
| InChI | InChI=1S/C9H13N3OS/c10-8-4-9(12-6-11-8)14-5-7-2-1-3-13-7/h4,6-7H,1-3,5H2,(H2,10,11,12) |
| InChIKey | ZFWIDGVRDSDIEJ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.29 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |