C6H10N4OS — CID 130639077
5-(oxolan-2-ylmethylsulfanyl)-2H-tetrazole (PubChem CID 130639077) has the molecular formula C6H10N4OS and a molecular weight of 186.24 g/mol. Its IUPAC name is 5-(oxolan-2-ylmethylsulfanyl)-2H-tetrazole.
| Compound Name | 5-(oxolan-2-ylmethylsulfanyl)-2H-tetrazole |
|---|---|
| PubChem CID | 130639077 |
| Molecular Formula | C6H10N4OS |
| Molecular Weight | 186.24 g/mol |
| Exact Mass | 186.06 |
| IUPAC Name | 5-(oxolan-2-ylmethylsulfanyl)-2H-tetrazole |
| SMILES | C1COC(CSc2nn[nH]n2)C1 |
| InChI | InChI=1S/C6H10N4OS/c1-2-5(11-3-1)4-12-6-7-9-10-8-6/h5H,1-4H2,(H,7,8,9,10) |
| InChIKey | FYSSDXWIKPEJAY-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.24 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |