C10H14N4O2S — CID 136955362
N'-hydroxy-5-(oxolan-2-ylmethylsulfanyl)pyrazine-2-carboximidamide (PubChem CID 136955362) has the molecular formula C10H14N4O2S and a molecular weight of 254.31 g/mol. Its IUPAC name is N'-hydroxy-5-(oxolan-2-ylmethylsulfanyl)pyrazine-2-carboximidamide.
| Compound Name | N'-hydroxy-5-(oxolan-2-ylmethylsulfanyl)pyrazine-2-carboximidamide |
|---|---|
| PubChem CID | 136955362 |
| Molecular Formula | C10H14N4O2S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | N'-hydroxy-5-(oxolan-2-ylmethylsulfanyl)pyrazine-2-carboximidamide |
| SMILES | NC(=NO)c1cnc(SCC2CCCO2)cn1 |
| InChI | InChI=1S/C10H14N4O2S/c11-10(14-15)8-4-13-9(5-12-8)17-6-7-2-1-3-16-7/h4-5,7,15H,1-3,6H2,(H2,11,14) |
| InChIKey | MCABIEHBCWHQHZ-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 93.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|