C13H12N4O3S — CID 137001413
5-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)-N'-hydroxypyrazine-2-carboximidamide (PubChem CID 137001413) has the molecular formula C13H12N4O3S and a molecular weight of 304.33 g/mol. Its IUPAC name is 5-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)-N'-hydroxypyrazine-2-carboximidamide.
| Compound Name | 5-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)-N'-hydroxypyrazine-2-carboximidamide |
|---|---|
| PubChem CID | 137001413 |
| Molecular Formula | C13H12N4O3S |
| Molecular Weight | 304.33 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 5-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)-N'-hydroxypyrazine-2-carboximidamide |
| SMILES | N/C(=N/O)c1cnc(Sc2ccc3c(c2)OCCO3)cn1 |
| InChI | InChI=1S/C13H12N4O3S/c14-13(17-18)9-6-16-12(7-15-9)21-8-1-2-10-11(5-8)20-4-3-19-10/h1-2,5-7,18H,3-4H2,(H2,14,17) |
| InChIKey | UNYASXDDJVDBIN-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 102.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.33 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|