C13H10ClNO2S — CID 113221068
2-chloro-6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)pyridine (PubChem CID 113221068) has the molecular formula C13H10ClNO2S and a molecular weight of 279.75 g/mol. Its IUPAC name is 2-chloro-6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)pyridine.
| Compound Name | 2-chloro-6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)pyridine |
|---|---|
| PubChem CID | 113221068 |
| Molecular Formula | C13H10ClNO2S |
| Molecular Weight | 279.75 g/mol |
| Exact Mass | 279.01 |
| IUPAC Name | 2-chloro-6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)pyridine |
| SMILES | Clc1cccc(Sc2ccc3c(c2)OCCO3)n1 |
| InChI | InChI=1S/C13H10ClNO2S/c14-12-2-1-3-13(15-12)18-9-4-5-10-11(8-9)17-7-6-16-10/h1-5,8H,6-7H2 |
| InChIKey | PXTLTCZWWCTNMG-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.75 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|