C13H11ClN2O2 — CID 60727080
6-chloro-N-(2,3-dihydro-1,4-benzodioxin-6-yl)pyridin-2-amine (PubChem CID 60727080) has the molecular formula C13H11ClN2O2 and a molecular weight of 262.70 g/mol. Its IUPAC name is 6-chloro-N-(2,3-dihydro-1,4-benzodioxin-6-yl)pyridin-2-amine.
| Compound Name | 6-chloro-N-(2,3-dihydro-1,4-benzodioxin-6-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 60727080 |
| Molecular Formula | C13H11ClN2O2 |
| Molecular Weight | 262.70 g/mol |
| Exact Mass | 262.05 |
| IUPAC Name | 6-chloro-N-(2,3-dihydro-1,4-benzodioxin-6-yl)pyridin-2-amine |
| SMILES | Clc1cccc(Nc2ccc3c(c2)OCCO3)n1 |
| InChI | InChI=1S/C13H11ClN2O2/c14-12-2-1-3-13(16-12)15-9-4-5-10-11(8-9)18-7-6-17-10/h1-5,8H,6-7H2,(H,15,16) |
| InChIKey | HJGAQWLNTRDKSC-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.70 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|