C14H12FNO2 — CID 82536030
N-(3-fluorophenyl)-2,3-dihydro-1,4-benzodioxin-6-amine (PubChem CID 82536030) has the molecular formula C14H12FNO2 and a molecular weight of 245.25 g/mol. Its IUPAC name is N-(3-fluorophenyl)-2,3-dihydro-1,4-benzodioxin-6-amine.
| Compound Name | N-(3-fluorophenyl)-2,3-dihydro-1,4-benzodioxin-6-amine |
|---|---|
| PubChem CID | 82536030 |
| Molecular Formula | C14H12FNO2 |
| Molecular Weight | 245.25 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | N-(3-fluorophenyl)-2,3-dihydro-1,4-benzodioxin-6-amine |
| SMILES | Fc1cccc(Nc2ccc3c(c2)OCCO3)c1 |
| InChI | InChI=1S/C14H12FNO2/c15-10-2-1-3-11(8-10)16-12-4-5-13-14(9-12)18-7-6-17-13/h1-5,8-9,16H,6-7H2 |
| InChIKey | XQMOJWJVTJIREF-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.25 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |